C21H21ClFN3O3S — CID 73147163
3-(4-chlorophenyl)-1-[(4-fluorophenyl)methyl]-6,7-dihydroxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzimidazole-4-carboxamide (PubChem CID 73147163) has the molecular formula C21H21ClFN3O3S and a molecular weight of 449.94 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[(4-fluorophenyl)methyl]-6,7-dihydroxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzimidazole-4-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-1-[(4-fluorophenyl)methyl]-6,7-dihydroxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 73147163 |
| Molecular Formula | C21H21ClFN3O3S |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[(4-fluorophenyl)methyl]-6,7-dihydroxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzimidazole-4-carboxamide |
| SMILES | NC(=O)C1CC(O)C(O)C2C1N(c1ccc(Cl)cc1)C(=S)N2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H21ClFN3O3S/c22-12-3-7-14(8-4-12)26-17-15(20(24)29)9-16(27)19(28)18(17)25(21(26)30)10-11-1-5-13(23)6-2-11/h1-8,15-19,27-28H,9-10H2,(H2,24,29) |
| InChIKey | VGSCAHQGZSNKSW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|