C21H29FN4O3S — CID 73147382
3-(4-fluorophenyl)-6,7-dihydroxy-N-(2-piperidin-1-ylethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide (PubChem CID 73147382) has the molecular formula C21H29FN4O3S and a molecular weight of 436.55 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-6,7-dihydroxy-N-(2-piperidin-1-ylethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-6,7-dihydroxy-N-(2-piperidin-1-ylethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 73147382 |
| Molecular Formula | C21H29FN4O3S |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 3-(4-fluorophenyl)-6,7-dihydroxy-N-(2-piperidin-1-ylethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(NCCN1CCCCC1)C1CC(O)C(O)C2NC(=S)N(c3ccc(F)cc3)C12 |
| InChI | InChI=1S/C21H29FN4O3S/c22-13-4-6-14(7-5-13)26-18-15(12-16(27)19(28)17(18)24-21(26)30)20(29)23-8-11-25-9-2-1-3-10-25/h4-7,15-19,27-28H,1-3,8-12H2,(H,23,29)(H,24,30) |
| InChIKey | SRCBMCCHFYQXJI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|