C23H24F3N3O3S — CID 73147416
N-benzyl-6,7-dihydroxy-N-methyl-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide (PubChem CID 73147416) has the molecular formula C23H24F3N3O3S and a molecular weight of 479.52 g/mol. Its IUPAC name is N-benzyl-6,7-dihydroxy-N-methyl-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | N-benzyl-6,7-dihydroxy-N-methyl-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 73147416 |
| Molecular Formula | C23H24F3N3O3S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | N-benzyl-6,7-dihydroxy-N-methyl-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)C1CC(O)C(O)C2NC(=S)N(c3cccc(C(F)(F)F)c3)C12 |
| InChI | InChI=1S/C23H24F3N3O3S/c1-28(12-13-6-3-2-4-7-13)21(32)16-11-17(30)20(31)18-19(16)29(22(33)27-18)15-9-5-8-14(10-15)23(24,25)26/h2-10,16-20,30-31H,11-12H2,1H3,(H,27,33) |
| InChIKey | XSJHXFAPXVSSRA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|