C19H24FN3O3S — CID 73147436
[3-(4-fluorophenyl)-6,7-dihydroxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-4-yl]-piperidin-1-ylmethanone (PubChem CID 73147436) has the molecular formula C19H24FN3O3S and a molecular weight of 393.48 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-6,7-dihydroxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [3-(4-fluorophenyl)-6,7-dihydroxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 73147436 |
| Molecular Formula | C19H24FN3O3S |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | [3-(4-fluorophenyl)-6,7-dihydroxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-4-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(C1CC(O)C(O)C2NC(=S)N(c3ccc(F)cc3)C12)N1CCCCC1 |
| InChI | InChI=1S/C19H24FN3O3S/c20-11-4-6-12(7-5-11)23-16-13(18(26)22-8-2-1-3-9-22)10-14(24)17(25)15(16)21-19(23)27/h4-7,13-17,24-25H,1-3,8-10H2,(H,21,27) |
| InChIKey | SSWQGVVGIFXBQB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|