C18H23F3N2O — CID 73149338
N-[(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)methyl]-4-(trifluoromethyl)benzamide (PubChem CID 73149338) has the molecular formula C18H23F3N2O and a molecular weight of 340.39 g/mol. Its IUPAC name is N-[(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)methyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)methyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 73149338 |
| Molecular Formula | C18H23F3N2O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-[(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)methyl]-4-(trifluoromethyl)benzamide |
| SMILES | CCC1CN2CCC1CC2CNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H23F3N2O/c1-2-12-11-23-8-7-14(12)9-16(23)10-22-17(24)13-3-5-15(6-4-13)18(19,20)21/h3-6,12,14,16H,2,7-11H2,1H3,(H,22,24) |
| InChIKey | KLMHSZDBXYZWAK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |