About 4-methylpyridine-2,5-dione
4-methylpyridine-2,5-dione (PubChem CID 73151446) has the molecular formula C6H5NO2
and a molecular weight of 123.11 g/mol. Its IUPAC name is 4-methylpyridine-2,5-dione.
Molecular Properties
| Compound Name | 4-methylpyridine-2,5-dione |
| PubChem CID | 73151446 |
| Molecular Formula | C6H5NO2 |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.03 |
| IUPAC Name | 4-methylpyridine-2,5-dione |
| SMILES | CC1=CC(=O)N=CC1=O |
| InChI | InChI=1S/C6H5NO2/c1-4-2-6(9)7-3-5(4)8/h2-3H,1H3 |
| InChIKey | ABPRHLQKUKWHHM-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylpyridine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpyridine-2,5-dione?
The IUPAC name of 4-methylpyridine-2,5-dione (CID 73151446) is 4-methylpyridine-2,5-dione.
What is the SMILES notation for 4-methylpyridine-2,5-dione?
The canonical SMILES for 4-methylpyridine-2,5-dione is CC1=CC(=O)N=CC1=O.
What is the InChIKey of 4-methylpyridine-2,5-dione?
The InChIKey is ABPRHLQKUKWHHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2/c1-4-2-6(9)7-3-5(4)8/h2-3H,1H3.
What are the key properties of 4-methylpyridine-2,5-dione?
4-methylpyridine-2,5-dione has a molecular weight of 123.11 g/mol, XLogP of 0.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpyridine-2,5-dione is sourced from PubChem (CID 73151446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).