About 1-methyl-3-(4-methylidenecyclohexa-1,5-dien-1-yl)thiourea
1-methyl-3-(4-methylidenecyclohexa-1,5-dien-1-yl)thiourea (PubChem CID 7315541) has the molecular formula C9H12N2S
and a molecular weight of 180.28 g/mol. Its IUPAC name is 1-methyl-3-(4-methylidenecyclohexa-1,5-dien-1-yl)thiourea.
Molecular Properties
| Compound Name | 1-methyl-3-(4-methylidenecyclohexa-1,5-dien-1-yl)thiourea |
| PubChem CID | 7315541 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 1-methyl-3-(4-methylidenecyclohexa-1,5-dien-1-yl)thiourea |
| SMILES | C=C1C=CC(NC(=S)NC)=CC1 |
| InChI | InChI=1S/C9H12N2S/c1-7-3-5-8(6-4-7)11-9(12)10-2/h3,5-6H,1,4H2,2H3,(H2,10,11,12) |
| InChIKey | CDZHLESVJGISOV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-(4-methylidenecyclohexa-1,5-dien-1-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(4-methylidenecyclohexa-1,5-dien-1-yl)thiourea?
The IUPAC name of 1-methyl-3-(4-methylidenecyclohexa-1,5-dien-1-yl)thiourea (CID 7315541) is 1-methyl-3-(4-methylidenecyclohexa-1,5-dien-1-yl)thiourea.
What is the SMILES notation for 1-methyl-3-(4-methylidenecyclohexa-1,5-dien-1-yl)thiourea?
The canonical SMILES for 1-methyl-3-(4-methylidenecyclohexa-1,5-dien-1-yl)thiourea is C=C1C=CC(NC(=S)NC)=CC1.
What is the InChIKey of 1-methyl-3-(4-methylidenecyclohexa-1,5-dien-1-yl)thiourea?
The InChIKey is CDZHLESVJGISOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2S/c1-7-3-5-8(6-4-7)11-9(12)10-2/h3,5-6H,1,4H2,2H3,(H2,10,11,12).
What are the key properties of 1-methyl-3-(4-methylidenecyclohexa-1,5-dien-1-yl)thiourea?
1-methyl-3-(4-methylidenecyclohexa-1,5-dien-1-yl)thiourea has a molecular weight of 180.28 g/mol, XLogP of 1.48, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(4-methylidenecyclohexa-1,5-dien-1-yl)thiourea is sourced from PubChem (CID 7315541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).