methyl (2R)-2-amino-2-naphthalen-1-ylacetate

C13H13NO2 — CID 7315730

IUPACmethyl (2R)-2-amino-2-naphthalen-1-ylacetate
SMILESCOC(=O)[C@H](N)c1cccc2ccccc12
InChIInChI=1S/C13H13NO2/c1-16-13(15)12(14)11-8-4-6-9-5-2-3-7-10(9)11/h2-8,12H,14H2,1H3/t12-/m1/s1
InChIKeyLTASPYVMQCESLM-GFCCVEGCSA-N
MW215.25 g/mol
LogP2.01
Rot. Bonds2

About methyl (2R)-2-amino-2-naphthalen-1-ylacetate

methyl (2R)-2-amino-2-naphthalen-1-ylacetate (PubChem CID 7315730) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is methyl (2R)-2-amino-2-naphthalen-1-ylacetate.

Molecular Properties

Compound Namemethyl (2R)-2-amino-2-naphthalen-1-ylacetate
PubChem CID7315730
Molecular FormulaC13H13NO2
Molecular Weight215.25 g/mol
Exact Mass215.09
IUPAC Namemethyl (2R)-2-amino-2-naphthalen-1-ylacetate
SMILESCOC(=O)[C@H](N)c1cccc2ccccc12
InChIInChI=1S/C13H13NO2/c1-16-13(15)12(14)11-8-4-6-9-5-2-3-7-10(9)11/h2-8,12H,14H2,1H3/t12-/m1/s1
InChIKeyLTASPYVMQCESLM-GFCCVEGCSA-N
XLogP2.01
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.25
LogP ≤ 52.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl (2R)-2-amino-2-naphthalen-1-ylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2R)-2-amino-2-naphthalen-1-ylacetate?
The IUPAC name of methyl (2R)-2-amino-2-naphthalen-1-ylacetate (CID 7315730) is methyl (2R)-2-amino-2-naphthalen-1-ylacetate.
What is the SMILES notation for methyl (2R)-2-amino-2-naphthalen-1-ylacetate?
The canonical SMILES for methyl (2R)-2-amino-2-naphthalen-1-ylacetate is COC(=O)[C@H](N)c1cccc2ccccc12.
What is the InChIKey of methyl (2R)-2-amino-2-naphthalen-1-ylacetate?
The InChIKey is LTASPYVMQCESLM-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H13NO2/c1-16-13(15)12(14)11-8-4-6-9-5-2-3-7-10(9)11/h2-8,12H,14H2,1H3/t12-/m1/s1.
What are the key properties of methyl (2R)-2-amino-2-naphthalen-1-ylacetate?
methyl (2R)-2-amino-2-naphthalen-1-ylacetate has a molecular weight of 215.25 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-amino-2-naphthalen-1-ylacetate is sourced from PubChem (CID 7315730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).