C8H16O4 — CID 73158423
1-(5,5-dimethyl-1,3-dioxan-2-yl)ethane-1,2-diol (PubChem CID 73158423) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is 1-(5,5-dimethyl-1,3-dioxan-2-yl)ethane-1,2-diol.
| Compound Name | 1-(5,5-dimethyl-1,3-dioxan-2-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 73158423 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 1-(5,5-dimethyl-1,3-dioxan-2-yl)ethane-1,2-diol |
| SMILES | CC1(C)COC(C(O)CO)OC1 |
| InChI | InChI=1S/C8H16O4/c1-8(2)4-11-7(12-5-8)6(10)3-9/h6-7,9-10H,3-5H2,1-2H3 |
| InChIKey | DGTZHTVYKHVVAD-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |