C15H20O3 — CID 73159315
4,4,7-trimethyl-3,5-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-9-one (PubChem CID 73159315) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 4,4,7-trimethyl-3,5-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-9-one.
| Compound Name | 4,4,7-trimethyl-3,5-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-9-one |
|---|---|
| PubChem CID | 73159315 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4,4,7-trimethyl-3,5-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-9-one |
| SMILES | CC1(C)OC2C3C=CC(C)(C2O1)C1C(=O)CCC31 |
| InChI | InChI=1S/C15H20O3/c1-14(2)17-12-9-6-7-15(3,13(12)18-14)11-8(9)4-5-10(11)16/h6-9,11-13H,4-5H2,1-3H3 |
| InChIKey | IJOQADRYDIVESW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|