C24H32N5O+ — CID 7316315
3-methyl-1-(2-morpholin-4-ium-4-ylethylamino)-2-pentylpyrido[1,2-a]benzimidazole-4-carbonitrile (PubChem CID 7316315) has the molecular formula C24H32N5O+ and a molecular weight of 406.55 g/mol. Its IUPAC name is 3-methyl-1-(2-morpholin-4-ium-4-ylethylamino)-2-pentylpyrido[1,2-a]benzimidazole-4-carbonitrile.
| Compound Name | 3-methyl-1-(2-morpholin-4-ium-4-ylethylamino)-2-pentylpyrido[1,2-a]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 7316315 |
| Molecular Formula | C24H32N5O+ |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 3-methyl-1-(2-morpholin-4-ium-4-ylethylamino)-2-pentylpyrido[1,2-a]benzimidazole-4-carbonitrile |
| SMILES | CCCCCc1c(C)c(C#N)c2nc3ccccc3n2c1NCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C24H31N5O/c1-3-4-5-8-19-18(2)20(17-25)24-27-21-9-6-7-10-22(21)29(24)23(19)26-11-12-28-13-15-30-16-14-28/h6-7,9-10,26H,3-5,8,11-16H2,1-2H3/p+1 |
| InChIKey | KTXHEYZXSPJALR-UHFFFAOYSA-O |
| XLogP | 2.73 |
| TPSA | 66.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|