C20H20N2O6S — CID 7316414
methyl (4R)-6-methyl-4-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 7316414) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is methyl (4R)-6-methyl-4-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl (4R)-6-methyl-4-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 7316414 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | methyl (4R)-6-methyl-4-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(=O)N[C@@H]1c1ccc(OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H20N2O6S/c1-12-4-10-16(11-5-12)29(25,26)28-15-8-6-14(7-9-15)18-17(19(23)27-3)13(2)21-20(24)22-18/h4-11,18H,1-3H3,(H2,21,22,24)/t18-/m1/s1 |
| InChIKey | OXJAFTBEONSMSA-GOSISDBHSA-N |
| XLogP | 2.56 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|