C14H16N5O+ — CID 73167568
4-[2-[(6-methyl-2H-[1,2,4]triazolo[4,3-b]pyridazin-4-ium-8-yl)amino]ethyl]phenol (PubChem CID 73167568) has the molecular formula C14H16N5O+ and a molecular weight of 270.32 g/mol. Its IUPAC name is 4-[2-[(6-methyl-2H-[1,2,4]triazolo[4,3-b]pyridazin-4-ium-8-yl)amino]ethyl]phenol.
| Compound Name | 4-[2-[(6-methyl-2H-[1,2,4]triazolo[4,3-b]pyridazin-4-ium-8-yl)amino]ethyl]phenol |
|---|---|
| PubChem CID | 73167568 |
| Molecular Formula | C14H16N5O+ |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 4-[2-[(6-methyl-2H-[1,2,4]triazolo[4,3-b]pyridazin-4-ium-8-yl)amino]ethyl]phenol |
| SMILES | Cc1cc(NCCc2ccc(O)cc2)c2n[nH]c[n+]2n1 |
| InChI | InChI=1S/C14H15N5O/c1-10-8-13(14-17-16-9-19(14)18-10)15-7-6-11-2-4-12(20)5-3-11/h2-5,8-9H,6-7H2,1H3,(H2,15,18,20)/p+1 |
| InChIKey | WMVBJQOGCIQFHG-UHFFFAOYSA-O |
| XLogP | 1.21 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|