About cyclopropyl-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]methanone
cyclopropyl-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]methanone (PubChem CID 73168830) has the molecular formula C10H12N2O2S
and a molecular weight of 224.28 g/mol. Its IUPAC name is cyclopropyl-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]methanone.
Molecular Properties
| Compound Name | cyclopropyl-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]methanone |
| PubChem CID | 73168830 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | cyclopropyl-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]methanone |
| SMILES | O=C(C1CC1)N1CC(Oc2nccs2)C1 |
| InChI | InChI=1S/C10H12N2O2S/c13-9(7-1-2-7)12-5-8(6-12)14-10-11-3-4-15-10/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | YVDPZYLAUYSDQP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclopropyl-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]methanone?
The IUPAC name of cyclopropyl-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]methanone (CID 73168830) is cyclopropyl-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]methanone.
What is the SMILES notation for cyclopropyl-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]methanone?
The canonical SMILES for cyclopropyl-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]methanone is O=C(C1CC1)N1CC(Oc2nccs2)C1.
What is the InChIKey of cyclopropyl-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]methanone?
The InChIKey is YVDPZYLAUYSDQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2S/c13-9(7-1-2-7)12-5-8(6-12)14-10-11-3-4-15-10/h3-4,7-8H,1-2,5-6H2.
What are the key properties of cyclopropyl-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]methanone?
cyclopropyl-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]methanone has a molecular weight of 224.28 g/mol, XLogP of 1.14, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]methanone is sourced from PubChem (CID 73168830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).