C16H16N6O2 — CID 73168949
2-methyl-6-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-11-carbonyl)pyridazin-3-one (PubChem CID 73168949) has the molecular formula C16H16N6O2 and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-methyl-6-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-11-carbonyl)pyridazin-3-one.
| Compound Name | 2-methyl-6-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-11-carbonyl)pyridazin-3-one |
|---|---|
| PubChem CID | 73168949 |
| Molecular Formula | C16H16N6O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-methyl-6-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-11-carbonyl)pyridazin-3-one |
| SMILES | Cc1cc2ncc3c(n2n1)CCN(C(=O)c1ccc(=O)n(C)n1)C3 |
| InChI | InChI=1S/C16H16N6O2/c1-10-7-14-17-8-11-9-21(6-5-13(11)22(14)18-10)16(24)12-3-4-15(23)20(2)19-12/h3-4,7-8H,5-6,9H2,1-2H3 |
| InChIKey | VJMBXFJHPOEPMV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |