C24H31O4PS — CID 73171902
(6-tert-butylsulfanyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl)oxy-diphenylphosphane (PubChem CID 73171902) has the molecular formula C24H31O4PS and a molecular weight of 446.55 g/mol. Its IUPAC name is (6-tert-butylsulfanyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl)oxy-diphenylphosphane.
| Compound Name | (6-tert-butylsulfanyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl)oxy-diphenylphosphane |
|---|---|
| PubChem CID | 73171902 |
| Molecular Formula | C24H31O4PS |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (6-tert-butylsulfanyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl)oxy-diphenylphosphane |
| SMILES | CC1(C)OC2COC(SC(C)(C)C)C(OP(c3ccccc3)c3ccccc3)C2O1 |
| InChI | InChI=1S/C24H31O4PS/c1-23(2,3)30-22-21(20-19(16-25-22)26-24(4,5)27-20)28-29(17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-15,19-22H,16H2,1-5H3 |
| InChIKey | SKXOBRWWYPIWKK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|