C20H15ClN3O4- — CID 7317234
4-[2-[(Z)-[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]pyrrol-1-yl]benzoate (PubChem CID 7317234) has the molecular formula C20H15ClN3O4- and a molecular weight of 396.81 g/mol. Its IUPAC name is 4-[2-[(Z)-[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]pyrrol-1-yl]benzoate.
| Compound Name | 4-[2-[(Z)-[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 7317234 |
| Molecular Formula | C20H15ClN3O4- |
| Molecular Weight | 396.81 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 4-[2-[(Z)-[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]pyrrol-1-yl]benzoate |
| SMILES | O=C(COc1ccc(Cl)cc1)N/N=C\c1cccn1-c1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C20H16ClN3O4/c21-15-5-9-18(10-6-15)28-13-19(25)23-22-12-17-2-1-11-24(17)16-7-3-14(4-8-16)20(26)27/h1-12H,13H2,(H,23,25)(H,26,27)/p-1/b22-12- |
| InChIKey | DORNKELBEXTPDD-UUYOSTAYSA-M |
| XLogP | 2.02 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.81 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|