C29H48O4 — CID 73174178
methyl 3-hydroxy-2-(3,8,8,14,18-pentamethyl-11-methylidenenonadeca-2,6,13,17-tetraenoxy)propanoate (PubChem CID 73174178) has the molecular formula C29H48O4 and a molecular weight of 460.70 g/mol. Its IUPAC name is methyl 3-hydroxy-2-(3,8,8,14,18-pentamethyl-11-methylidenenonadeca-2,6,13,17-tetraenoxy)propanoate.
| Compound Name | methyl 3-hydroxy-2-(3,8,8,14,18-pentamethyl-11-methylidenenonadeca-2,6,13,17-tetraenoxy)propanoate |
|---|---|
| PubChem CID | 73174178 |
| Molecular Formula | C29H48O4 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | methyl 3-hydroxy-2-(3,8,8,14,18-pentamethyl-11-methylidenenonadeca-2,6,13,17-tetraenoxy)propanoate |
| SMILES | C=C(CC=C(C)CCC=C(C)C)CCC(C)(C)C=CCCC(C)=CCOC(CO)C(=O)OC |
| InChI | InChI=1S/C29H48O4/c1-23(2)12-11-14-24(3)15-16-26(5)17-20-29(6,7)19-10-9-13-25(4)18-21-33-27(22-30)28(31)32-8/h10,12,15,18-19,27,30H,5,9,11,13-14,16-17,20-22H2,1-4,6-8H3 |
| InChIKey | VATSHTCOYRKIQM-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|