About N-methoxy-1-[1-[3-(1,3-thiazol-2-ylmethoxymethyl)phenyl]benzimidazol-5-yl]methanimine
N-methoxy-1-[1-[3-(1,3-thiazol-2-ylmethoxymethyl)phenyl]benzimidazol-5-yl]methanimine (PubChem CID 73174852) has the molecular formula C20H18N4O2S
and a molecular weight of 378.46 g/mol. Its IUPAC name is N-methoxy-1-[1-[3-(1,3-thiazol-2-ylmethoxymethyl)phenyl]benzimidazol-5-yl]methanimine.
Molecular Properties
| Compound Name | N-methoxy-1-[1-[3-(1,3-thiazol-2-ylmethoxymethyl)phenyl]benzimidazol-5-yl]methanimine |
| PubChem CID | 73174852 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-methoxy-1-[1-[3-(1,3-thiazol-2-ylmethoxymethyl)phenyl]benzimidazol-5-yl]methanimine |
| SMILES | CON=Cc1ccc2c(c1)ncn2-c1cccc(COCc2nccs2)c1 |
| InChI | InChI=1S/C20H18N4O2S/c1-25-23-11-15-5-6-19-18(10-15)22-14-24(19)17-4-2-3-16(9-17)12-26-13-20-21-7-8-27-20/h2-11,14H,12-13H2,1H3 |
| InChIKey | ZJKFCGNHSOFNEX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 61.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-1-[1-[3-(1,3-thiazol-2-ylmethoxymethyl)phenyl]benzimidazol-5-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-1-[1-[3-(1,3-thiazol-2-ylmethoxymethyl)phenyl]benzimidazol-5-yl]methanimine?
The IUPAC name of N-methoxy-1-[1-[3-(1,3-thiazol-2-ylmethoxymethyl)phenyl]benzimidazol-5-yl]methanimine (CID 73174852) is N-methoxy-1-[1-[3-(1,3-thiazol-2-ylmethoxymethyl)phenyl]benzimidazol-5-yl]methanimine.
What is the SMILES notation for N-methoxy-1-[1-[3-(1,3-thiazol-2-ylmethoxymethyl)phenyl]benzimidazol-5-yl]methanimine?
The canonical SMILES for N-methoxy-1-[1-[3-(1,3-thiazol-2-ylmethoxymethyl)phenyl]benzimidazol-5-yl]methanimine is CON=Cc1ccc2c(c1)ncn2-c1cccc(COCc2nccs2)c1.
What is the InChIKey of N-methoxy-1-[1-[3-(1,3-thiazol-2-ylmethoxymethyl)phenyl]benzimidazol-5-yl]methanimine?
The InChIKey is ZJKFCGNHSOFNEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O2S/c1-25-23-11-15-5-6-19-18(10-15)22-14-24(19)17-4-2-3-16(9-17)12-26-13-20-21-7-8-27-20/h2-11,14H,12-13H2,1H3.
What are the key properties of N-methoxy-1-[1-[3-(1,3-thiazol-2-ylmethoxymethyl)phenyl]benzimidazol-5-yl]methanimine?
N-methoxy-1-[1-[3-(1,3-thiazol-2-ylmethoxymethyl)phenyl]benzimidazol-5-yl]methanimine has a molecular weight of 378.46 g/mol, XLogP of 4.18, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-1-[1-[3-(1,3-thiazol-2-ylmethoxymethyl)phenyl]benzimidazol-5-yl]methanimine is sourced from PubChem (CID 73174852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).