C29H29N5O5 — CID 73175253
ethyl N-[5'-cyano-1-(diethoxymethyl)-3'-methyl-2-oxo-1'-phenylspiro[indole-3,4'-pyrano[3,2-d]pyrazole]-6'-yl]methanimidate (PubChem CID 73175253) has the molecular formula C29H29N5O5 and a molecular weight of 527.58 g/mol. Its IUPAC name is ethyl N-[5'-cyano-1-(diethoxymethyl)-3'-methyl-2-oxo-1'-phenylspiro[indole-3,4'-pyrano[3,2-d]pyrazole]-6'-yl]methanimidate.
| Compound Name | ethyl N-[5'-cyano-1-(diethoxymethyl)-3'-methyl-2-oxo-1'-phenylspiro[indole-3,4'-pyrano[3,2-d]pyrazole]-6'-yl]methanimidate |
|---|---|
| PubChem CID | 73175253 |
| Molecular Formula | C29H29N5O5 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | ethyl N-[5'-cyano-1-(diethoxymethyl)-3'-methyl-2-oxo-1'-phenylspiro[indole-3,4'-pyrano[3,2-d]pyrazole]-6'-yl]methanimidate |
| SMILES | CCOC=NC1=C(C#N)C2(C(=O)N(C(OCC)OCC)c3ccccc32)c2c(C)nn(-c3ccccc3)c2O1 |
| InChI | InChI=1S/C29H29N5O5/c1-5-36-18-31-25-22(17-30)29(24-19(4)32-34(26(24)39-25)20-13-9-8-10-14-20)21-15-11-12-16-23(21)33(27(29)35)28(37-6-2)38-7-3/h8-16,18,28H,5-7H2,1-4H3 |
| InChIKey | NSXXHWCQVGGIOC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 111.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|