C20H19NO6-2 — CID 7317544
5-[[2-(4-tert-butylphenoxy)acetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 7317544) has the molecular formula C20H19NO6-2 and a molecular weight of 369.37 g/mol. Its IUPAC name is 5-[[2-(4-tert-butylphenoxy)acetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | 5-[[2-(4-tert-butylphenoxy)acetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 7317544 |
| Molecular Formula | C20H19NO6-2 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 5-[[2-(4-tert-butylphenoxy)acetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | CC(C)(C)c1ccc(OCC(=O)Nc2cc(C(=O)[O-])cc(C(=O)[O-])c2)cc1 |
| InChI | InChI=1S/C20H21NO6/c1-20(2,3)14-4-6-16(7-5-14)27-11-17(22)21-15-9-12(18(23)24)8-13(10-15)19(25)26/h4-10H,11H2,1-3H3,(H,21,22)(H,23,24)(H,25,26)/p-2 |
| InChIKey | HAYYPKRVDBWKJF-UHFFFAOYSA-L |
| XLogP | 0.73 |
| TPSA | 118.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |