C12H15N4O6- — CID 7317561
(2R)-2-[(2-amino-1,3-dimethyl-4,6-dioxopyrimidin-1-ium-5-yl)methylideneamino]pentanedioate (PubChem CID 7317561) has the molecular formula C12H15N4O6- and a molecular weight of 311.27 g/mol. Its IUPAC name is (2R)-2-[(2-amino-1,3-dimethyl-4,6-dioxopyrimidin-1-ium-5-yl)methylideneamino]pentanedioate.
| Compound Name | (2R)-2-[(2-amino-1,3-dimethyl-4,6-dioxopyrimidin-1-ium-5-yl)methylideneamino]pentanedioate |
|---|---|
| PubChem CID | 7317561 |
| Molecular Formula | C12H15N4O6- |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | (2R)-2-[(2-amino-1,3-dimethyl-4,6-dioxopyrimidin-1-ium-5-yl)methylideneamino]pentanedioate |
| SMILES | CN1C(=O)C(/C=N/[C@H](CCC(=O)[O-])C(=O)[O-])C(=O)[N+](C)=C1N |
| InChI | InChI=1S/C12H16N4O6/c1-15-9(19)6(10(20)16(2)12(15)13)5-14-7(11(21)22)3-4-8(17)18/h5-7,13H,3-4H2,1-2H3,(H2,17,18,21,22)/p-1/b14-5+/t7-/m1/s1 |
| InChIKey | GDQLGYQJUSMWQK-LTCVEOEISA-M |
| XLogP | -4.72 |
| TPSA | 159.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | -4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|