C21H23BrN2O4 — CID 73180117
2-[4-bromo-3-(3-prop-2-enoxyiminobutan-2-yloxy)phenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 73180117) has the molecular formula C21H23BrN2O4 and a molecular weight of 447.33 g/mol. Its IUPAC name is 2-[4-bromo-3-(3-prop-2-enoxyiminobutan-2-yloxy)phenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[4-bromo-3-(3-prop-2-enoxyiminobutan-2-yloxy)phenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 73180117 |
| Molecular Formula | C21H23BrN2O4 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 2-[4-bromo-3-(3-prop-2-enoxyiminobutan-2-yloxy)phenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | C=CCON=C(C)C(C)Oc1cc(N2C(=O)C3=C(CCCC3)C2=O)ccc1Br |
| InChI | InChI=1S/C21H23BrN2O4/c1-4-11-27-23-13(2)14(3)28-19-12-15(9-10-18(19)22)24-20(25)16-7-5-6-8-17(16)21(24)26/h4,9-10,12,14H,1,5-8,11H2,2-3H3 |
| InChIKey | IKSLGOIIPXIQRC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|