C20H30N2O3 — CID 7318082
(3S)-3-methyl-N-[[(2S)-oxolan-2-yl]methyl]-N'-(4-propan-2-ylphenyl)pentanediamide (PubChem CID 7318082) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is (3S)-3-methyl-N-[[(2S)-oxolan-2-yl]methyl]-N'-(4-propan-2-ylphenyl)pentanediamide.
| Compound Name | (3S)-3-methyl-N-[[(2S)-oxolan-2-yl]methyl]-N'-(4-propan-2-ylphenyl)pentanediamide |
|---|---|
| PubChem CID | 7318082 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (3S)-3-methyl-N-[[(2S)-oxolan-2-yl]methyl]-N'-(4-propan-2-ylphenyl)pentanediamide |
| SMILES | CC(C)c1ccc(NC(=O)C[C@@H](C)CC(=O)NC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C20H30N2O3/c1-14(2)16-6-8-17(9-7-16)22-20(24)12-15(3)11-19(23)21-13-18-5-4-10-25-18/h6-9,14-15,18H,4-5,10-13H2,1-3H3,(H,21,23)(H,22,24)/t15-,18-/m0/s1 |
| InChIKey | HQZSRCMVPZVONQ-YJBOKZPZSA-N |
| XLogP | 3.46 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |