2-hydroxyiminopentanoic acid

C5H9NO3 — CID 73183763

IUPAC2-hydroxyiminopentanoic acid
SMILESCCCC(=NO)C(=O)O
InChIInChI=1S/C5H9NO3/c1-2-3-4(6-9)5(7)8/h9H,2-3H2,1H3,(H,7,8)
InChIKeyNYGKICXHEWAHQP-UHFFFAOYSA-N
MW131.13 g/mol
LogP0.70
Rot. Bonds3

About 2-hydroxyiminopentanoic acid

2-hydroxyiminopentanoic acid (PubChem CID 73183763) has the molecular formula C5H9NO3 and a molecular weight of 131.13 g/mol. Its IUPAC name is 2-hydroxyiminopentanoic acid.

Molecular Properties

Compound Name2-hydroxyiminopentanoic acid
PubChem CID73183763
Molecular FormulaC5H9NO3
Molecular Weight131.13 g/mol
Exact Mass131.06
IUPAC Name2-hydroxyiminopentanoic acid
SMILESCCCC(=NO)C(=O)O
InChIInChI=1S/C5H9NO3/c1-2-3-4(6-9)5(7)8/h9H,2-3H2,1H3,(H,7,8)
InChIKeyNYGKICXHEWAHQP-UHFFFAOYSA-N
XLogP0.70
TPSA69.89 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500131.13
LogP ≤ 50.70
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-hydroxyiminopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxyiminopentanoic acid?
The IUPAC name of 2-hydroxyiminopentanoic acid (CID 73183763) is 2-hydroxyiminopentanoic acid.
What is the SMILES notation for 2-hydroxyiminopentanoic acid?
The canonical SMILES for 2-hydroxyiminopentanoic acid is CCCC(=NO)C(=O)O.
What is the InChIKey of 2-hydroxyiminopentanoic acid?
The InChIKey is NYGKICXHEWAHQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3/c1-2-3-4(6-9)5(7)8/h9H,2-3H2,1H3,(H,7,8).
What are the key properties of 2-hydroxyiminopentanoic acid?
2-hydroxyiminopentanoic acid has a molecular weight of 131.13 g/mol, XLogP of 0.70, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyiminopentanoic acid is sourced from PubChem (CID 73183763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).