About 2,3-dimethoxyprop-2-enoic acid
2,3-dimethoxyprop-2-enoic acid (PubChem CID 73186284) has the molecular formula C5H8O4
and a molecular weight of 132.11 g/mol. Its IUPAC name is 2,3-dimethoxyprop-2-enoic acid.
Molecular Properties
| Compound Name | 2,3-dimethoxyprop-2-enoic acid |
| PubChem CID | 73186284 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.11 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | 2,3-dimethoxyprop-2-enoic acid |
| SMILES | COC=C(OC)C(=O)O |
| InChI | InChI=1S/C5H8O4/c1-8-3-4(9-2)5(6)7/h3H,1-2H3,(H,6,7) |
| InChIKey | YAMYPUYJMPXJPH-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.11 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethoxyprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethoxyprop-2-enoic acid?
The IUPAC name of 2,3-dimethoxyprop-2-enoic acid (CID 73186284) is 2,3-dimethoxyprop-2-enoic acid.
What is the SMILES notation for 2,3-dimethoxyprop-2-enoic acid?
The canonical SMILES for 2,3-dimethoxyprop-2-enoic acid is COC=C(OC)C(=O)O.
What is the InChIKey of 2,3-dimethoxyprop-2-enoic acid?
The InChIKey is YAMYPUYJMPXJPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O4/c1-8-3-4(9-2)5(6)7/h3H,1-2H3,(H,6,7).
What are the key properties of 2,3-dimethoxyprop-2-enoic acid?
2,3-dimethoxyprop-2-enoic acid has a molecular weight of 132.11 g/mol, XLogP of 0.21, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxyprop-2-enoic acid is sourced from PubChem (CID 73186284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).