C17H21N3O — CID 73188200
3-amino-2-(2-methylocta-1,6-dien-4-yl)quinazolin-4-one (PubChem CID 73188200) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 3-amino-2-(2-methylocta-1,6-dien-4-yl)quinazolin-4-one.
| Compound Name | 3-amino-2-(2-methylocta-1,6-dien-4-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 73188200 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3-amino-2-(2-methylocta-1,6-dien-4-yl)quinazolin-4-one |
| SMILES | C=C(C)CC(CC=CC)c1nc2ccccc2c(=O)n1N |
| InChI | InChI=1S/C17H21N3O/c1-4-5-8-13(11-12(2)3)16-19-15-10-7-6-9-14(15)17(21)20(16)18/h4-7,9-10,13H,2,8,11,18H2,1,3H3 |
| InChIKey | XFGSUSBOZUBOMC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|