C6H9N5O — CID 73188274
2-amino-2,3,6,7-tetrahydro-1H-pteridin-4-one (PubChem CID 73188274) has the molecular formula C6H9N5O and a molecular weight of 167.17 g/mol. Its IUPAC name is 2-amino-2,3,6,7-tetrahydro-1H-pteridin-4-one.
| Compound Name | 2-amino-2,3,6,7-tetrahydro-1H-pteridin-4-one |
|---|---|
| PubChem CID | 73188274 |
| Molecular Formula | C6H9N5O |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 2-amino-2,3,6,7-tetrahydro-1H-pteridin-4-one |
| SMILES | NC1NC(=O)C2=NCCN=C2N1 |
| InChI | InChI=1S/C6H9N5O/c7-6-10-4-3(5(12)11-6)8-1-2-9-4/h6H,1-2,7H2,(H,9,10)(H,11,12) |
| InChIKey | FMXISFBIIIIIAA-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 91.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |