C26H27NO5 — CID 73189309
5-O-benzyl 3-O-hexa-2,4-dienyl 4-(furan-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 73189309) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is 5-O-benzyl 3-O-hexa-2,4-dienyl 4-(furan-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-benzyl 3-O-hexa-2,4-dienyl 4-(furan-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 73189309 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 5-O-benzyl 3-O-hexa-2,4-dienyl 4-(furan-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC=CC=CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCc2ccccc2)C1c1ccco1 |
| InChI | InChI=1S/C26H27NO5/c1-4-5-6-10-15-31-25(28)22-18(2)27-19(3)23(24(22)21-14-11-16-30-21)26(29)32-17-20-12-8-7-9-13-20/h4-14,16,24,27H,15,17H2,1-3H3 |
| InChIKey | ZQXRMFQXCLCBPT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|