C15H22O — CID 73189547
4,11,11-trimethyl-8-methylidene-10-oxatricyclo[7.2.1.03,7]dodec-4-ene (PubChem CID 73189547) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 4,11,11-trimethyl-8-methylidene-10-oxatricyclo[7.2.1.03,7]dodec-4-ene.
| Compound Name | 4,11,11-trimethyl-8-methylidene-10-oxatricyclo[7.2.1.03,7]dodec-4-ene |
|---|---|
| PubChem CID | 73189547 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 4,11,11-trimethyl-8-methylidene-10-oxatricyclo[7.2.1.03,7]dodec-4-ene |
| SMILES | C=C1C2CC(CC3C(C)=CCC13)C(C)(C)O2 |
| InChI | InChI=1S/C15H22O/c1-9-5-6-12-10(2)14-8-11(7-13(9)12)15(3,4)16-14/h5,11-14H,2,6-8H2,1,3-4H3 |
| InChIKey | UCHRRMWFDLTRHF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|