C8H6N2O4 — CID 73190234
2,7-diazatricyclo[6.2.0.03,6]decane-4,5,9,10-tetrone (PubChem CID 73190234) has the molecular formula C8H6N2O4 and a molecular weight of 194.15 g/mol. Its IUPAC name is 2,7-diazatricyclo[6.2.0.03,6]decane-4,5,9,10-tetrone.
| Compound Name | 2,7-diazatricyclo[6.2.0.03,6]decane-4,5,9,10-tetrone |
|---|---|
| PubChem CID | 73190234 |
| Molecular Formula | C8H6N2O4 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 2,7-diazatricyclo[6.2.0.03,6]decane-4,5,9,10-tetrone |
| SMILES | O=C1C(=O)C2NC3C(=O)C(=O)C3NC12 |
| InChI | InChI=1S/C8H6N2O4/c11-5-1-2(6(5)12)10-4-3(9-1)7(13)8(4)14/h1-4,9-10H |
| InChIKey | UDUUQDWQJRQATA-UHFFFAOYSA-N |
| XLogP | -3.04 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|