About pyridazino[4,5-b]quinoline-1,4-dione
pyridazino[4,5-b]quinoline-1,4-dione (PubChem CID 73192756) has the molecular formula C11H5N3O2
and a molecular weight of 211.18 g/mol. Its IUPAC name is pyridazino[4,5-b]quinoline-1,4-dione.
Molecular Properties
| Compound Name | pyridazino[4,5-b]quinoline-1,4-dione |
| PubChem CID | 73192756 |
| Molecular Formula | C11H5N3O2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | pyridazino[4,5-b]quinoline-1,4-dione |
| SMILES | O=C1N=NC(=O)c2nc3ccccc3cc21 |
| InChI | InChI=1S/C11H5N3O2/c15-10-7-5-6-3-1-2-4-8(6)12-9(7)11(16)14-13-10/h1-5H |
| InChIKey | XNQJIUJFYRTHQP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 71.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridazino[4,5-b]quinoline-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridazino[4,5-b]quinoline-1,4-dione?
The IUPAC name of pyridazino[4,5-b]quinoline-1,4-dione (CID 73192756) is pyridazino[4,5-b]quinoline-1,4-dione.
What is the SMILES notation for pyridazino[4,5-b]quinoline-1,4-dione?
The canonical SMILES for pyridazino[4,5-b]quinoline-1,4-dione is O=C1N=NC(=O)c2nc3ccccc3cc21.
What is the InChIKey of pyridazino[4,5-b]quinoline-1,4-dione?
The InChIKey is XNQJIUJFYRTHQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5N3O2/c15-10-7-5-6-3-1-2-4-8(6)12-9(7)11(16)14-13-10/h1-5H.
What are the key properties of pyridazino[4,5-b]quinoline-1,4-dione?
pyridazino[4,5-b]quinoline-1,4-dione has a molecular weight of 211.18 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridazino[4,5-b]quinoline-1,4-dione is sourced from PubChem (CID 73192756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).