C16H30NO2+ — CID 7319650
(2S,4S,5R)-4-[(E)-2-(1-hydroxycyclohexyl)ethenyl]-1,2,5-trimethylpiperidin-1-ium-4-ol (PubChem CID 7319650) has the molecular formula C16H30NO2+ and a molecular weight of 268.42 g/mol. Its IUPAC name is (2S,4S,5R)-4-[(E)-2-(1-hydroxycyclohexyl)ethenyl]-1,2,5-trimethylpiperidin-1-ium-4-ol.
| Compound Name | (2S,4S,5R)-4-[(E)-2-(1-hydroxycyclohexyl)ethenyl]-1,2,5-trimethylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7319650 |
| Molecular Formula | C16H30NO2+ |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | (2S,4S,5R)-4-[(E)-2-(1-hydroxycyclohexyl)ethenyl]-1,2,5-trimethylpiperidin-1-ium-4-ol |
| SMILES | C[C@@H]1C[NH+](C)[C@@H](C)C[C@]1(O)/C=C/C1(O)CCCCC1 |
| InChI | InChI=1S/C16H29NO2/c1-13-12-17(3)14(2)11-16(13,19)10-9-15(18)7-5-4-6-8-15/h9-10,13-14,18-19H,4-8,11-12H2,1-3H3/p+1/b10-9+/t13-,14+,16-/m1/s1 |
| InChIKey | HAKHECCJGGYZQK-JCYOYESHSA-O |
| XLogP | 0.91 |
| TPSA | 44.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|