C18H19F2NO2 — CID 73197188
1-(2,4-difluorophenyl)-N-(2-methyl-1-phenylmethoxypropan-2-yl)methanimine oxide (PubChem CID 73197188) has the molecular formula C18H19F2NO2 and a molecular weight of 319.35 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-(2-methyl-1-phenylmethoxypropan-2-yl)methanimine oxide.
| Compound Name | 1-(2,4-difluorophenyl)-N-(2-methyl-1-phenylmethoxypropan-2-yl)methanimine oxide |
|---|---|
| PubChem CID | 73197188 |
| Molecular Formula | C18H19F2NO2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-(2-methyl-1-phenylmethoxypropan-2-yl)methanimine oxide |
| SMILES | CC(C)(COCc1ccccc1)[N+]([O-])=Cc1ccc(F)cc1F |
| InChI | InChI=1S/C18H19F2NO2/c1-18(2,13-23-12-14-6-4-3-5-7-14)21(22)11-15-8-9-16(19)10-17(15)20/h3-11H,12-13H2,1-2H3 |
| InChIKey | IXYYOXAEQIJSIG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|