C16H21N3O — CID 73198397
4-phenyl-2,3,4,4a,5,5a,6,7,8,9,9a,9b-dodecahydropyridazino[4,5-b]indol-1-one (PubChem CID 73198397) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-phenyl-2,3,4,4a,5,5a,6,7,8,9,9a,9b-dodecahydropyridazino[4,5-b]indol-1-one.
| Compound Name | 4-phenyl-2,3,4,4a,5,5a,6,7,8,9,9a,9b-dodecahydropyridazino[4,5-b]indol-1-one |
|---|---|
| PubChem CID | 73198397 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 4-phenyl-2,3,4,4a,5,5a,6,7,8,9,9a,9b-dodecahydropyridazino[4,5-b]indol-1-one |
| SMILES | O=C1NNC(c2ccccc2)C2NC3CCCCC3C12 |
| InChI | InChI=1S/C16H21N3O/c20-16-13-11-8-4-5-9-12(11)17-15(13)14(18-19-16)10-6-2-1-3-7-10/h1-3,6-7,11-15,17-18H,4-5,8-9H2,(H,19,20) |
| InChIKey | AHRYZSRKADMFKM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |