About N,N-dimethyl-N'-(4-methyl-1,2,4-triazol-3-yl)methanimidamide
N,N-dimethyl-N'-(4-methyl-1,2,4-triazol-3-yl)methanimidamide (PubChem CID 73198464) has the molecular formula C6H11N5
and a molecular weight of 153.19 g/mol. Its IUPAC name is N,N-dimethyl-N'-(4-methyl-1,2,4-triazol-3-yl)methanimidamide.
Molecular Properties
| Compound Name | N,N-dimethyl-N'-(4-methyl-1,2,4-triazol-3-yl)methanimidamide |
| PubChem CID | 73198464 |
| Molecular Formula | C6H11N5 |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | N,N-dimethyl-N'-(4-methyl-1,2,4-triazol-3-yl)methanimidamide |
| SMILES | CN(C)C=Nc1nncn1C |
| InChI | InChI=1S/C6H11N5/c1-10(2)4-7-6-9-8-5-11(6)3/h4-5H,1-3H3 |
| InChIKey | DBVCUFSKPWEVFZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-N'-(4-methyl-1,2,4-triazol-3-yl)methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-N'-(4-methyl-1,2,4-triazol-3-yl)methanimidamide?
The IUPAC name of N,N-dimethyl-N'-(4-methyl-1,2,4-triazol-3-yl)methanimidamide (CID 73198464) is N,N-dimethyl-N'-(4-methyl-1,2,4-triazol-3-yl)methanimidamide.
What is the SMILES notation for N,N-dimethyl-N'-(4-methyl-1,2,4-triazol-3-yl)methanimidamide?
The canonical SMILES for N,N-dimethyl-N'-(4-methyl-1,2,4-triazol-3-yl)methanimidamide is CN(C)C=Nc1nncn1C.
What is the InChIKey of N,N-dimethyl-N'-(4-methyl-1,2,4-triazol-3-yl)methanimidamide?
The InChIKey is DBVCUFSKPWEVFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N5/c1-10(2)4-7-6-9-8-5-11(6)3/h4-5H,1-3H3.
What are the key properties of N,N-dimethyl-N'-(4-methyl-1,2,4-triazol-3-yl)methanimidamide?
N,N-dimethyl-N'-(4-methyl-1,2,4-triazol-3-yl)methanimidamide has a molecular weight of 153.19 g/mol, XLogP of 0.04, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-N'-(4-methyl-1,2,4-triazol-3-yl)methanimidamide is sourced from PubChem (CID 73198464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).