C17H16N2O2S — CID 7319989
(5S)-5-(N,4-dimethylanilino)-3-phenyl-1,3-thiazolidine-2,4-dione (PubChem CID 7319989) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is (5S)-5-(N,4-dimethylanilino)-3-phenyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5S)-5-(N,4-dimethylanilino)-3-phenyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 7319989 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (5S)-5-(N,4-dimethylanilino)-3-phenyl-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(N(C)[C@H]2SC(=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C17H16N2O2S/c1-12-8-10-13(11-9-12)18(2)16-15(20)19(17(21)22-16)14-6-4-3-5-7-14/h3-11,16H,1-2H3/t16-/m0/s1 |
| InChIKey | RDOFVUZJSMGNOA-INIZCTEOSA-N |
| XLogP | 3.66 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|