C20H30O2 — CID 73199958
6'-hydroxy-5,6',7a-trimethyl-3-propan-2-ylspiro[3a,5,6,7-tetrahydroindene-4,3'-cyclohexene]-1-one (PubChem CID 73199958) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 6'-hydroxy-5,6',7a-trimethyl-3-propan-2-ylspiro[3a,5,6,7-tetrahydroindene-4,3'-cyclohexene]-1-one.
| Compound Name | 6'-hydroxy-5,6',7a-trimethyl-3-propan-2-ylspiro[3a,5,6,7-tetrahydroindene-4,3'-cyclohexene]-1-one |
|---|---|
| PubChem CID | 73199958 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 6'-hydroxy-5,6',7a-trimethyl-3-propan-2-ylspiro[3a,5,6,7-tetrahydroindene-4,3'-cyclohexene]-1-one |
| SMILES | CC(C)C1=CC(=O)C2(C)CCC(C)C3(C=CC(C)(O)CC3)C12 |
| InChI | InChI=1S/C20H30O2/c1-13(2)15-12-16(21)19(5)7-6-14(3)20(17(15)19)10-8-18(4,22)9-11-20/h8,10,12-14,17,22H,6-7,9,11H2,1-5H3 |
| InChIKey | DHFSZFPDRAAZAV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|