C42H47N2O7P — CID 73204711
dibenzyl [1,10-dihydroxy-6-oxo-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-3-yl] phosphate (PubChem CID 73204711) has the molecular formula C42H47N2O7P and a molecular weight of 722.82 g/mol. Its IUPAC name is dibenzyl [1,10-dihydroxy-6-oxo-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-3-yl] phosphate.
| Compound Name | dibenzyl [1,10-dihydroxy-6-oxo-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-3-yl] phosphate |
|---|---|
| PubChem CID | 73204711 |
| Molecular Formula | C42H47N2O7P |
| Molecular Weight | 722.82 g/mol |
| Exact Mass | 722.31 |
| IUPAC Name | dibenzyl [1,10-dihydroxy-6-oxo-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-3-yl] phosphate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCN1C(=O)c2cccc(O)c2Nc2c(O)cc(OP(=O)(OCc3ccccc3)OCc3ccccc3)cc21 |
| InChI | InChI=1S/C42H47N2O7P/c1-30(2)14-11-15-31(3)16-12-17-32(4)24-25-44-37-26-35(27-39(46)41(37)43-40-36(42(44)47)22-13-23-38(40)45)51-52(48,49-28-33-18-7-5-8-19-33)50-29-34-20-9-6-10-21-34/h5-10,13-14,16,18-24,26-27,43,45-46H,11-12,15,17,25,28-29H2,1-4H3 |
| InChIKey | RILNZBZHCNHDJJ-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.82 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|