About (3R,4R)-1,3-dimethyl-4-prop-2-enylpiperidin-1-ium-4-ol
(3R,4R)-1,3-dimethyl-4-prop-2-enylpiperidin-1-ium-4-ol (PubChem CID 7320634) has the molecular formula C10H20NO+
and a molecular weight of 170.28 g/mol. Its IUPAC name is (3R,4R)-1,3-dimethyl-4-prop-2-enylpiperidin-1-ium-4-ol.
Molecular Properties
| Compound Name | (3R,4R)-1,3-dimethyl-4-prop-2-enylpiperidin-1-ium-4-ol |
| PubChem CID | 7320634 |
| Molecular Formula | C10H20NO+ |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | (3R,4R)-1,3-dimethyl-4-prop-2-enylpiperidin-1-ium-4-ol |
| SMILES | C=CC[C@@]1(O)CC[NH+](C)C[C@H]1C |
| InChI | InChI=1S/C10H19NO/c1-4-5-10(12)6-7-11(3)8-9(10)2/h4,9,12H,1,5-8H2,2-3H3/p+1/t9-,10-/m1/s1 |
| InChIKey | MPESFAHJDPBCSL-NXEZZACHSA-O |
| XLogP | -0.15 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R,4R)-1,3-dimethyl-4-prop-2-enylpiperidin-1-ium-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-1,3-dimethyl-4-prop-2-enylpiperidin-1-ium-4-ol?
The IUPAC name of (3R,4R)-1,3-dimethyl-4-prop-2-enylpiperidin-1-ium-4-ol (CID 7320634) is (3R,4R)-1,3-dimethyl-4-prop-2-enylpiperidin-1-ium-4-ol.
What is the SMILES notation for (3R,4R)-1,3-dimethyl-4-prop-2-enylpiperidin-1-ium-4-ol?
The canonical SMILES for (3R,4R)-1,3-dimethyl-4-prop-2-enylpiperidin-1-ium-4-ol is C=CC[C@@]1(O)CC[NH+](C)C[C@H]1C.
What is the InChIKey of (3R,4R)-1,3-dimethyl-4-prop-2-enylpiperidin-1-ium-4-ol?
The InChIKey is MPESFAHJDPBCSL-NXEZZACHSA-O. The full InChI is InChI=1S/C10H19NO/c1-4-5-10(12)6-7-11(3)8-9(10)2/h4,9,12H,1,5-8H2,2-3H3/p+1/t9-,10-/m1/s1.
What are the key properties of (3R,4R)-1,3-dimethyl-4-prop-2-enylpiperidin-1-ium-4-ol?
(3R,4R)-1,3-dimethyl-4-prop-2-enylpiperidin-1-ium-4-ol has a molecular weight of 170.28 g/mol, XLogP of -0.15, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-1,3-dimethyl-4-prop-2-enylpiperidin-1-ium-4-ol is sourced from PubChem (CID 7320634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).