About 2,4-dinitroaniline
2,4-dinitroaniline (PubChem CID 7321) has the molecular formula C6H5N3O4
and a molecular weight of 183.12 g/mol. Its IUPAC name is 2,4-dinitroaniline.
Molecular Properties
| Compound Name | 2,4-dinitroaniline |
| PubChem CID | 7321 |
| Molecular Formula | C6H5N3O4 |
| Molecular Weight | 183.12 g/mol |
| Exact Mass | 183.03 |
| IUPAC Name | 2,4-dinitroaniline |
| SMILES | Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H5N3O4/c7-5-2-1-4(8(10)11)3-6(5)9(12)13/h1-3H,7H2 |
| InChIKey | LXQOQPGNCGEELI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.12 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dinitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dinitroaniline?
The IUPAC name of 2,4-dinitroaniline (CID 7321) is 2,4-dinitroaniline.
What is the SMILES notation for 2,4-dinitroaniline?
The canonical SMILES for 2,4-dinitroaniline is Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of 2,4-dinitroaniline?
The InChIKey is LXQOQPGNCGEELI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O4/c7-5-2-1-4(8(10)11)3-6(5)9(12)13/h1-3H,7H2.
What are the key properties of 2,4-dinitroaniline?
2,4-dinitroaniline has a molecular weight of 183.12 g/mol, XLogP of 1.09, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dinitroaniline is sourced from PubChem (CID 7321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).