C28H27ClN4O5 — CID 73211772
(3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(4-morpholin-2-ylphenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 73211772) has the molecular formula C28H27ClN4O5 and a molecular weight of 535.00 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(4-morpholin-2-ylphenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(4-morpholin-2-ylphenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 73211772 |
| Molecular Formula | C28H27ClN4O5 |
| Molecular Weight | 535.00 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(4-morpholin-2-ylphenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2Oc1nc2nc(-c3ccc(-c4ccc(C5CNCCO5)cc4)cc3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C28H27ClN4O5/c29-19-11-20-27(33-28(31-20)38-23-14-37-25-21(34)13-36-26(23)25)32-24(19)18-7-3-16(4-8-18)15-1-5-17(6-2-15)22-12-30-9-10-35-22/h1-8,11,21-23,25-26,30,34H,9-10,12-14H2,(H,31,32,33)/t21-,22?,23-,25-,26-/m1/s1 |
| InChIKey | OVKPOUHOEFKASA-YZIGLVHXSA-N |
| XLogP | 3.51 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.00 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |