About 5-pyridin-3-yl-2,6-bis(pyridin-3-ylmethyl)pyrimidin-4-amine
5-pyridin-3-yl-2,6-bis(pyridin-3-ylmethyl)pyrimidin-4-amine (PubChem CID 73211790) has the molecular formula C21H18N6
and a molecular weight of 354.42 g/mol. Its IUPAC name is 5-pyridin-3-yl-2,6-bis(pyridin-3-ylmethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-pyridin-3-yl-2,6-bis(pyridin-3-ylmethyl)pyrimidin-4-amine |
| PubChem CID | 73211790 |
| Molecular Formula | C21H18N6 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 5-pyridin-3-yl-2,6-bis(pyridin-3-ylmethyl)pyrimidin-4-amine |
| SMILES | Nc1nc(Cc2cccnc2)nc(Cc2cccnc2)c1-c1cccnc1 |
| InChI | InChI=1S/C21H18N6/c22-21-20(17-6-3-9-25-14-17)18(10-15-4-1-7-23-12-15)26-19(27-21)11-16-5-2-8-24-13-16/h1-9,12-14H,10-11H2,(H2,22,26,27) |
| InChIKey | UHTNAEDGRDTZNB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-pyridin-3-yl-2,6-bis(pyridin-3-ylmethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyridin-3-yl-2,6-bis(pyridin-3-ylmethyl)pyrimidin-4-amine?
The IUPAC name of 5-pyridin-3-yl-2,6-bis(pyridin-3-ylmethyl)pyrimidin-4-amine (CID 73211790) is 5-pyridin-3-yl-2,6-bis(pyridin-3-ylmethyl)pyrimidin-4-amine.
What is the SMILES notation for 5-pyridin-3-yl-2,6-bis(pyridin-3-ylmethyl)pyrimidin-4-amine?
The canonical SMILES for 5-pyridin-3-yl-2,6-bis(pyridin-3-ylmethyl)pyrimidin-4-amine is Nc1nc(Cc2cccnc2)nc(Cc2cccnc2)c1-c1cccnc1.
What is the InChIKey of 5-pyridin-3-yl-2,6-bis(pyridin-3-ylmethyl)pyrimidin-4-amine?
The InChIKey is UHTNAEDGRDTZNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N6/c22-21-20(17-6-3-9-25-14-17)18(10-15-4-1-7-23-12-15)26-19(27-21)11-16-5-2-8-24-13-16/h1-9,12-14H,10-11H2,(H2,22,26,27).
What are the key properties of 5-pyridin-3-yl-2,6-bis(pyridin-3-ylmethyl)pyrimidin-4-amine?
5-pyridin-3-yl-2,6-bis(pyridin-3-ylmethyl)pyrimidin-4-amine has a molecular weight of 354.42 g/mol, XLogP of 3.09, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyridin-3-yl-2,6-bis(pyridin-3-ylmethyl)pyrimidin-4-amine is sourced from PubChem (CID 73211790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).