C23H28FNO3 — CID 73211959
1-(4-fluorophenyl)-2-phenoxy-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethanone (PubChem CID 73211959) has the molecular formula C23H28FNO3 and a molecular weight of 385.48 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-phenoxy-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethanone.
| Compound Name | 1-(4-fluorophenyl)-2-phenoxy-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethanone |
|---|---|
| PubChem CID | 73211959 |
| Molecular Formula | C23H28FNO3 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 1-(4-fluorophenyl)-2-phenoxy-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethanone |
| SMILES | CC1(C)CCCC(C)(C)N1OC(Oc1ccccc1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H28FNO3/c1-22(2)15-8-16-23(3,4)25(22)28-21(27-19-9-6-5-7-10-19)20(26)17-11-13-18(24)14-12-17/h5-7,9-14,21H,8,15-16H2,1-4H3 |
| InChIKey | NUZSFGJVHPVOHT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|