About 2-bromo-3-fluoro-N,N-di(propan-2-yl)benzamide
2-bromo-3-fluoro-N,N-di(propan-2-yl)benzamide (PubChem CID 73212046) has the molecular formula C13H17BrFNO
and a molecular weight of 302.19 g/mol. Its IUPAC name is 2-bromo-3-fluoro-N,N-di(propan-2-yl)benzamide.
Molecular Properties
| Compound Name | 2-bromo-3-fluoro-N,N-di(propan-2-yl)benzamide |
| PubChem CID | 73212046 |
| Molecular Formula | C13H17BrFNO |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2-bromo-3-fluoro-N,N-di(propan-2-yl)benzamide |
| SMILES | CC(C)N(C(=O)c1cccc(F)c1Br)C(C)C |
| InChI | InChI=1S/C13H17BrFNO/c1-8(2)16(9(3)4)13(17)10-6-5-7-11(15)12(10)14/h5-9H,1-4H3 |
| InChIKey | YZJWJKCTIAWPHR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-3-fluoro-N,N-di(propan-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3-fluoro-N,N-di(propan-2-yl)benzamide?
The IUPAC name of 2-bromo-3-fluoro-N,N-di(propan-2-yl)benzamide (CID 73212046) is 2-bromo-3-fluoro-N,N-di(propan-2-yl)benzamide.
What is the SMILES notation for 2-bromo-3-fluoro-N,N-di(propan-2-yl)benzamide?
The canonical SMILES for 2-bromo-3-fluoro-N,N-di(propan-2-yl)benzamide is CC(C)N(C(=O)c1cccc(F)c1Br)C(C)C.
What is the InChIKey of 2-bromo-3-fluoro-N,N-di(propan-2-yl)benzamide?
The InChIKey is YZJWJKCTIAWPHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BrFNO/c1-8(2)16(9(3)4)13(17)10-6-5-7-11(15)12(10)14/h5-9H,1-4H3.
What are the key properties of 2-bromo-3-fluoro-N,N-di(propan-2-yl)benzamide?
2-bromo-3-fluoro-N,N-di(propan-2-yl)benzamide has a molecular weight of 302.19 g/mol, XLogP of 3.85, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-fluoro-N,N-di(propan-2-yl)benzamide is sourced from PubChem (CID 73212046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).