C15H22O3 — CID 73212333
(6S,6aS,7R,9aR)-7-hydroxy-6,8,8-trimethyl-1,4,5,6,6a,7,9,9a-octahydroazuleno[4,5-c]furan-3-one (PubChem CID 73212333) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (6S,6aS,7R,9aR)-7-hydroxy-6,8,8-trimethyl-1,4,5,6,6a,7,9,9a-octahydroazuleno[4,5-c]furan-3-one.
| Compound Name | (6S,6aS,7R,9aR)-7-hydroxy-6,8,8-trimethyl-1,4,5,6,6a,7,9,9a-octahydroazuleno[4,5-c]furan-3-one |
|---|---|
| PubChem CID | 73212333 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (6S,6aS,7R,9aR)-7-hydroxy-6,8,8-trimethyl-1,4,5,6,6a,7,9,9a-octahydroazuleno[4,5-c]furan-3-one |
| SMILES | C[C@H]1CCC2=C(COC2=O)[C@@H]2CC(C)(C)[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C15H22O3/c1-8-4-5-9-11(7-18-14(9)17)10-6-15(2,3)13(16)12(8)10/h8,10,12-13,16H,4-7H2,1-3H3/t8-,10-,12-,13+/m0/s1 |
| InChIKey | GJYUZTXDAIRNMY-SKZLGDCLSA-N |
| XLogP | 2.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |