C15H14O5 — CID 73212405
(9S)-5-methoxy-9,10-dihydrophenanthrene-2,4,7,9-tetrol (PubChem CID 73212405) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is (9S)-5-methoxy-9,10-dihydrophenanthrene-2,4,7,9-tetrol.
| Compound Name | (9S)-5-methoxy-9,10-dihydrophenanthrene-2,4,7,9-tetrol |
|---|---|
| PubChem CID | 73212405 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (9S)-5-methoxy-9,10-dihydrophenanthrene-2,4,7,9-tetrol |
| SMILES | COc1cc(O)cc2c1-c1c(O)cc(O)cc1C[C@@H]2O |
| InChI | InChI=1S/C15H14O5/c1-20-13-6-9(17)4-10-11(18)3-7-2-8(16)5-12(19)14(7)15(10)13/h2,4-6,11,16-19H,3H2,1H3/t11-/m0/s1 |
| InChIKey | KGKREBUEHMRSJB-NSHDSACASA-N |
| XLogP | 2.07 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |