C17H18O2 — CID 73212506
6-hydroxy-1,1,7-trimethyl-3,4-dihydrophenanthren-2-one (PubChem CID 73212506) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 6-hydroxy-1,1,7-trimethyl-3,4-dihydrophenanthren-2-one.
| Compound Name | 6-hydroxy-1,1,7-trimethyl-3,4-dihydrophenanthren-2-one |
|---|---|
| PubChem CID | 73212506 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 6-hydroxy-1,1,7-trimethyl-3,4-dihydrophenanthren-2-one |
| SMILES | Cc1cc2ccc3c(c2cc1O)CCC(=O)C3(C)C |
| InChI | InChI=1S/C17H18O2/c1-10-8-11-4-6-14-12(13(11)9-15(10)18)5-7-16(19)17(14,2)3/h4,6,8-9,18H,5,7H2,1-3H3 |
| InChIKey | AFACAVFCDGVGIB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |