About [(1S,2S)-2-anilinocyclohexyl] N,N-dimethylcarbamate;hydrochloride
[(1S,2S)-2-anilinocyclohexyl] N,N-dimethylcarbamate;hydrochloride (PubChem CID 73212566) has the molecular formula C15H23ClN2O2
and a molecular weight of 298.81 g/mol. Its IUPAC name is [(1S,2S)-2-anilinocyclohexyl] N,N-dimethylcarbamate;hydrochloride.
Molecular Properties
| Compound Name | [(1S,2S)-2-anilinocyclohexyl] N,N-dimethylcarbamate;hydrochloride |
| PubChem CID | 73212566 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | [(1S,2S)-2-anilinocyclohexyl] N,N-dimethylcarbamate;hydrochloride |
| SMILES | CN(C)C(=O)O[C@H]1CCCC[C@@H]1Nc1ccccc1.Cl |
| InChI | InChI=1S/C15H22N2O2.ClH/c1-17(2)15(18)19-14-11-7-6-10-13(14)16-12-8-4-3-5-9-12;/h3-5,8-9,13-14,16H,6-7,10-11H2,1-2H3;1H/t13-,14-;/m0./s1 |
| InChIKey | LKDUCBYZTXSASC-IODNYQNNSA-N |
| XLogP | 3.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S,2S)-2-anilinocyclohexyl] N,N-dimethylcarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-anilinocyclohexyl] N,N-dimethylcarbamate;hydrochloride?
The IUPAC name of [(1S,2S)-2-anilinocyclohexyl] N,N-dimethylcarbamate;hydrochloride (CID 73212566) is [(1S,2S)-2-anilinocyclohexyl] N,N-dimethylcarbamate;hydrochloride.
What is the SMILES notation for [(1S,2S)-2-anilinocyclohexyl] N,N-dimethylcarbamate;hydrochloride?
The canonical SMILES for [(1S,2S)-2-anilinocyclohexyl] N,N-dimethylcarbamate;hydrochloride is CN(C)C(=O)O[C@H]1CCCC[C@@H]1Nc1ccccc1.Cl.
What is the InChIKey of [(1S,2S)-2-anilinocyclohexyl] N,N-dimethylcarbamate;hydrochloride?
The InChIKey is LKDUCBYZTXSASC-IODNYQNNSA-N. The full InChI is InChI=1S/C15H22N2O2.ClH/c1-17(2)15(18)19-14-11-7-6-10-13(14)16-12-8-4-3-5-9-12;/h3-5,8-9,13-14,16H,6-7,10-11H2,1-2H3;1H/t13-,14-;/m0./s1.
What are the key properties of [(1S,2S)-2-anilinocyclohexyl] N,N-dimethylcarbamate;hydrochloride?
[(1S,2S)-2-anilinocyclohexyl] N,N-dimethylcarbamate;hydrochloride has a molecular weight of 298.81 g/mol, XLogP of 3.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-anilinocyclohexyl] N,N-dimethylcarbamate;hydrochloride is sourced from PubChem (CID 73212566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).