About CID 73212627
CID 73212627 (PubChem CID 73212627) has the molecular formula C12H10FN2O2
and a molecular weight of 233.22 g/mol.
Molecular Properties
| Compound Name | CID 73212627 |
| PubChem CID | 73212627 |
| Molecular Formula | C12H10FN2O2 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | — |
| SMILES | O=c1[nH]c(=O)n(C/C=C/[C]2[CH][CH][CH][CH]2)cc1F |
| InChI | InChI=1S/C12H10FN2O2/c13-10-8-15(12(17)14-11(10)16)7-3-6-9-4-1-2-5-9/h1-6,8H,7H2,(H,14,16,17)/b6-3+ |
| InChIKey | HVGFQPHQMRIKGM-ZZXKWVIFSA-N |
| XLogP | 0.64 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 73212627 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 73212627?
The IUPAC name of CID 73212627 (CID 73212627) is not available.
What is the SMILES notation for CID 73212627?
The canonical SMILES for CID 73212627 is O=c1[nH]c(=O)n(C/C=C/[C]2[CH][CH][CH][CH]2)cc1F.
What is the InChIKey of CID 73212627?
The InChIKey is HVGFQPHQMRIKGM-ZZXKWVIFSA-N. The full InChI is InChI=1S/C12H10FN2O2/c13-10-8-15(12(17)14-11(10)16)7-3-6-9-4-1-2-5-9/h1-6,8H,7H2,(H,14,16,17)/b6-3+.
What are the key properties of CID 73212627?
CID 73212627 has a molecular weight of 233.22 g/mol, XLogP of 0.64, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 73212627 is sourced from PubChem (CID 73212627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).